C30H37NO6S — CID 59644063
[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-(2-phenylethyl)oxan-4-yl] 3-methylbut-2-enoate (PubChem CID 59644063) has the molecular formula C30H37NO6S and a molecular weight of 539.69 g/mol. Its IUPAC name is [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-(2-phenylethyl)oxan-4-yl] 3-methylbut-2-enoate.
| Compound Name | [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-(2-phenylethyl)oxan-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 59644063 |
| Molecular Formula | C30H37NO6S |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-(2-phenylethyl)oxan-4-yl] 3-methylbut-2-enoate |
| SMILES | COc1ccc(CN2C(=O)SC[C@H]2[C@@]2(OC)C[C@H](OC(=O)C=C(C)C)C[C@@H](CCc3ccccc3)O2)cc1 |
| InChI | InChI=1S/C30H37NO6S/c1-21(2)16-28(32)36-26-17-25(15-10-22-8-6-5-7-9-22)37-30(18-26,35-4)27-20-38-29(33)31(27)19-23-11-13-24(34-3)14-12-23/h5-9,11-14,16,25-27H,10,15,17-20H2,1-4H3/t25-,26-,27+,30-/m1/s1 |
| InChIKey | KRHAIDZBZMTECN-KMFVSHEXSA-N |
| XLogP | 5.77 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|