C31H43NO6S — CID 67440416
[(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-[(3S)-3-methylpent-4-enyl]oxan-4-yl] 3-methylhepta-2,6-dienoate (PubChem CID 67440416) has the molecular formula C31H43NO6S and a molecular weight of 557.75 g/mol. Its IUPAC name is [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-[(3S)-3-methylpent-4-enyl]oxan-4-yl] 3-methylhepta-2,6-dienoate.
| Compound Name | [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-[(3S)-3-methylpent-4-enyl]oxan-4-yl] 3-methylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 67440416 |
| Molecular Formula | C31H43NO6S |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | [(2R,4R,6R)-2-methoxy-2-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-[(3S)-3-methylpent-4-enyl]oxan-4-yl] 3-methylhepta-2,6-dienoate |
| SMILES | C=CCCC(C)=CC(=O)O[C@@H]1C[C@@H](CC[C@H](C)C=C)O[C@@](OC)([C@@H]2CSC(=O)N2Cc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C31H43NO6S/c1-7-9-10-23(4)17-29(33)37-27-18-26(14-11-22(3)8-2)38-31(19-27,36-6)28-21-39-30(34)32(28)20-24-12-15-25(35-5)16-13-24/h7-8,12-13,15-17,22,26-28H,1-2,9-11,14,18-21H2,3-6H3/t22-,26-,27-,28+,31-/m1/s1 |
| InChIKey | BSJAVHQTNNEPDR-FUDFBKDZSA-N |
| XLogP | 6.68 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|