C29H41NO6S — CID 67439039
[2-methoxy-2-[3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pent-4-enyloxan-4-yl] hept-6-enoate (PubChem CID 67439039) has the molecular formula C29H41NO6S and a molecular weight of 531.72 g/mol. Its IUPAC name is [2-methoxy-2-[3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pent-4-enyloxan-4-yl] hept-6-enoate.
| Compound Name | [2-methoxy-2-[3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pent-4-enyloxan-4-yl] hept-6-enoate |
|---|---|
| PubChem CID | 67439039 |
| Molecular Formula | C29H41NO6S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [2-methoxy-2-[3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-6-pent-4-enyloxan-4-yl] hept-6-enoate |
| SMILES | C=CCCCCC(=O)OC1CC(CCCC=C)OC(OC)(C2CSC(=O)N2Cc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C29H41NO6S/c1-5-7-9-11-13-27(31)35-25-18-24(12-10-8-6-2)36-29(19-25,34-4)26-21-37-28(32)30(26)20-22-14-16-23(33-3)17-15-22/h5-6,14-17,24-26H,1-2,7-13,18-21H2,3-4H3 |
| InChIKey | OTCSBBLFKVARCE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|