C19H16BrF4N3O5 — CID 165386520
[8-(4-bromo-2-fluoroanilino)-2-(2-hydroxyethyl)-7-methyl-1,6-dioxo-3,4-dihydro-2,7-naphthyridin-3-yl] 2,2,2-trifluoroacetate (PubChem CID 165386520) has the molecular formula C19H16BrF4N3O5 and a molecular weight of 522.25 g/mol. Its IUPAC name is [8-(4-bromo-2-fluoroanilino)-2-(2-hydroxyethyl)-7-methyl-1,6-dioxo-3,4-dihydro-2,7-naphthyridin-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [8-(4-bromo-2-fluoroanilino)-2-(2-hydroxyethyl)-7-methyl-1,6-dioxo-3,4-dihydro-2,7-naphthyridin-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165386520 |
| Molecular Formula | C19H16BrF4N3O5 |
| Molecular Weight | 522.25 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | [8-(4-bromo-2-fluoroanilino)-2-(2-hydroxyethyl)-7-methyl-1,6-dioxo-3,4-dihydro-2,7-naphthyridin-3-yl] 2,2,2-trifluoroacetate |
| SMILES | Cn1c(Nc2ccc(Br)cc2F)c2c(cc1=O)CC(OC(=O)C(F)(F)F)N(CCO)C2=O |
| InChI | InChI=1S/C19H16BrF4N3O5/c1-26-13(29)6-9-7-14(32-18(31)19(22,23)24)27(4-5-28)17(30)15(9)16(26)25-12-3-2-10(20)8-11(12)21/h2-3,6,8,14,25,28H,4-5,7H2,1H3 |
| InChIKey | QXGFLOSWBVLLEG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|