C22H15BrF5N5O2S — CID 165389593
N-[2-[[(4-bromo-2-pyridinyl)methylideneamino]carbamoyl]-4,6-difluorophenyl]-3-ethylsulfanyl-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 165389593) has the molecular formula C22H15BrF5N5O2S and a molecular weight of 588.36 g/mol. Its IUPAC name is N-[2-[[(4-bromo-2-pyridinyl)methylideneamino]carbamoyl]-4,6-difluorophenyl]-3-ethylsulfanyl-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[2-[[(4-bromo-2-pyridinyl)methylideneamino]carbamoyl]-4,6-difluorophenyl]-3-ethylsulfanyl-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 165389593 |
| Molecular Formula | C22H15BrF5N5O2S |
| Molecular Weight | 588.36 g/mol |
| Exact Mass | 587.00 |
| IUPAC Name | N-[2-[[(4-bromo-2-pyridinyl)methylideneamino]carbamoyl]-4,6-difluorophenyl]-3-ethylsulfanyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | CCSc1cc(C(F)(F)F)cnc1C(=O)Nc1c(F)cc(F)cc1C(=O)NN=Cc1cc(Br)ccn1 |
| InChI | InChI=1S/C22H15BrF5N5O2S/c1-2-36-17-5-11(22(26,27)28)9-30-19(17)21(35)32-18-15(7-13(24)8-16(18)25)20(34)33-31-10-14-6-12(23)3-4-29-14/h3-10H,2H2,1H3,(H,32,35)(H,33,34) |
| InChIKey | SOVXVWFTZUPZEO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.36 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|