C40H72IO2P — CID 165390084
[5-[(E)-11,11-didecoxyundec-4-enyl]-2,3,4-trimethylphenyl]-iodophosphane (PubChem CID 165390084) has the molecular formula C40H72IO2P and a molecular weight of 742.89 g/mol. Its IUPAC name is [5-[(E)-11,11-didecoxyundec-4-enyl]-2,3,4-trimethylphenyl]-iodophosphane.
| Compound Name | [5-[(E)-11,11-didecoxyundec-4-enyl]-2,3,4-trimethylphenyl]-iodophosphane |
|---|---|
| PubChem CID | 165390084 |
| Molecular Formula | C40H72IO2P |
| Molecular Weight | 742.89 g/mol |
| Exact Mass | 742.43 |
| IUPAC Name | [5-[(E)-11,11-didecoxyundec-4-enyl]-2,3,4-trimethylphenyl]-iodophosphane |
| SMILES | CCCCCCCCCCOC(CCCCC/C=C/CCCc1cc(PI)c(C)c(C)c1C)OCCCCCCCCCC |
| InChI | InChI=1S/C40H72IO2P/c1-6-8-10-12-14-20-24-28-32-42-40(43-33-29-25-21-15-13-11-9-7-2)31-27-23-19-17-16-18-22-26-30-38-34-39(44-41)37(5)35(3)36(38)4/h16,18,34,40,44H,6-15,17,19-33H2,1-5H3/b18-16+ |
| InChIKey | KKNBTUPFSGTHOR-FBMGVBCBSA-N |
| XLogP | 13.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.89 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|