C26H44BrO2P — CID 165390069
bromo-[5-[(Z)-11,11-dipropoxyundec-4-enyl]-2,3,4-trimethylphenyl]phosphane (PubChem CID 165390069) has the molecular formula C26H44BrO2P and a molecular weight of 499.51 g/mol. Its IUPAC name is bromo-[5-[(Z)-11,11-dipropoxyundec-4-enyl]-2,3,4-trimethylphenyl]phosphane.
| Compound Name | bromo-[5-[(Z)-11,11-dipropoxyundec-4-enyl]-2,3,4-trimethylphenyl]phosphane |
|---|---|
| PubChem CID | 165390069 |
| Molecular Formula | C26H44BrO2P |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | bromo-[5-[(Z)-11,11-dipropoxyundec-4-enyl]-2,3,4-trimethylphenyl]phosphane |
| SMILES | CCCOC(CCCCC/C=C\CCCc1cc(PBr)c(C)c(C)c1C)OCCC |
| InChI | InChI=1S/C26H44BrO2P/c1-6-18-28-26(29-19-7-2)17-15-13-11-9-8-10-12-14-16-24-20-25(30-27)23(5)21(3)22(24)4/h8,10,20,26,30H,6-7,9,11-19H2,1-5H3/b10-8- |
| InChIKey | FASPXXACBVUAES-NTMALXAHSA-N |
| XLogP | 8.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|