C38H68ClO2P — CID 165390097
chloro-[5-[(Z)-11,11-di(nonoxy)undec-4-enyl]-2,3,4-trimethylphenyl]phosphane (PubChem CID 165390097) has the molecular formula C38H68ClO2P and a molecular weight of 623.39 g/mol. Its IUPAC name is chloro-[5-[(Z)-11,11-di(nonoxy)undec-4-enyl]-2,3,4-trimethylphenyl]phosphane.
| Compound Name | chloro-[5-[(Z)-11,11-di(nonoxy)undec-4-enyl]-2,3,4-trimethylphenyl]phosphane |
|---|---|
| PubChem CID | 165390097 |
| Molecular Formula | C38H68ClO2P |
| Molecular Weight | 623.39 g/mol |
| Exact Mass | 622.46 |
| IUPAC Name | chloro-[5-[(Z)-11,11-di(nonoxy)undec-4-enyl]-2,3,4-trimethylphenyl]phosphane |
| SMILES | CCCCCCCCCOC(CCCCC/C=C\CCCc1cc(PCl)c(C)c(C)c1C)OCCCCCCCCC |
| InChI | InChI=1S/C38H68ClO2P/c1-6-8-10-12-18-22-26-30-40-38(41-31-27-23-19-13-11-9-7-2)29-25-21-17-15-14-16-20-24-28-36-32-37(42-39)35(5)33(3)34(36)4/h14,16,32,38,42H,6-13,15,17-31H2,1-5H3/b16-14- |
| InChIKey | STNNPQFUQYJWJV-PEZBUJJGSA-N |
| XLogP | 12.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.39 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|