C48H73IO2P+ — CID 165175074
[3-[(E)-11,11-dioctoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium (PubChem CID 165175074) has the molecular formula C48H73IO2P+ and a molecular weight of 839.99 g/mol. Its IUPAC name is [3-[(E)-11,11-dioctoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium.
| Compound Name | [3-[(E)-11,11-dioctoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 165175074 |
| Molecular Formula | C48H73IO2P+ |
| Molecular Weight | 839.99 g/mol |
| Exact Mass | 839.44 |
| IUPAC Name | [3-[(E)-11,11-dioctoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium |
| SMILES | CCCCCCCCOC(CCCCC/C=C/CCCc1cccc([P+](I)(c2ccccc2C)c2ccccc2C)c1C)OCCCCCCCC |
| InChI | InChI=1S/C48H73IO2P/c1-6-8-10-12-20-28-39-50-48(51-40-29-21-13-11-9-7-2)38-23-19-17-15-14-16-18-22-33-44-34-30-37-47(43(44)5)52(49,45-35-26-24-31-41(45)3)46-36-27-25-32-42(46)4/h14,16,24-27,30-32,34-37,48H,6-13,15,17-23,28-29,33,38-40H2,1-5H3/q+1/b16-14+ |
| InChIKey | SXHMQPIKQKDGQL-JQIJEIRASA-N |
| XLogP | 14.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.99 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|