C40H57ClO2P+ — CID 165175097
chloro-[3-[(E)-11,11-dibutoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium (PubChem CID 165175097) has the molecular formula C40H57ClO2P+ and a molecular weight of 636.32 g/mol. Its IUPAC name is chloro-[3-[(E)-11,11-dibutoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium.
| Compound Name | chloro-[3-[(E)-11,11-dibutoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 165175097 |
| Molecular Formula | C40H57ClO2P+ |
| Molecular Weight | 636.32 g/mol |
| Exact Mass | 635.38 |
| IUPAC Name | chloro-[3-[(E)-11,11-dibutoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium |
| SMILES | CCCCOC(CCCCC/C=C/CCCc1cccc([P+](Cl)(c2ccccc2C)c2ccccc2C)c1C)OCCCC |
| InChI | InChI=1S/C40H57ClO2P/c1-6-8-31-42-40(43-32-9-7-2)30-17-15-13-11-10-12-14-16-25-36-26-22-29-39(35(36)5)44(41,37-27-20-18-23-33(37)3)38-28-21-19-24-34(38)4/h10,12,18-24,26-29,40H,6-9,11,13-17,25,30-32H2,1-5H3/q+1/b12-10+ |
| InChIKey | LUASNOOMGGRYDT-ZRDIBKRKSA-N |
| XLogP | 10.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.32 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|