C38H53BrO2P+ — CID 165174902
bromo-[3-[(E)-11,11-dipropoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium (PubChem CID 165174902) has the molecular formula C38H53BrO2P+ and a molecular weight of 652.72 g/mol. Its IUPAC name is bromo-[3-[(E)-11,11-dipropoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium.
| Compound Name | bromo-[3-[(E)-11,11-dipropoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 165174902 |
| Molecular Formula | C38H53BrO2P+ |
| Molecular Weight | 652.72 g/mol |
| Exact Mass | 651.30 |
| IUPAC Name | bromo-[3-[(E)-11,11-dipropoxyundec-4-enyl]-2-methylphenyl]-bis(2-methylphenyl)phosphanium |
| SMILES | CCCOC(CCCCC/C=C/CCCc1cccc([P+](Br)(c2ccccc2C)c2ccccc2C)c1C)OCCC |
| InChI | InChI=1S/C38H53BrO2P/c1-6-29-40-38(41-30-7-2)28-15-13-11-9-8-10-12-14-23-34-24-20-27-37(33(34)5)42(39,35-25-18-16-21-31(35)3)36-26-19-17-22-32(36)4/h8,10,16-22,24-27,38H,6-7,9,11-15,23,28-30H2,1-5H3/q+1/b10-8+ |
| InChIKey | KHGKMEKUEYDVLR-CSKARUKUSA-N |
| XLogP | 10.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.72 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|