C44H65IO2P+ — CID 165174955
[3-[(Z)-11,11-dihexoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium (PubChem CID 165174955) has the molecular formula C44H65IO2P+ and a molecular weight of 783.88 g/mol. Its IUPAC name is [3-[(Z)-11,11-dihexoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium.
| Compound Name | [3-[(Z)-11,11-dihexoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium |
|---|---|
| PubChem CID | 165174955 |
| Molecular Formula | C44H65IO2P+ |
| Molecular Weight | 783.88 g/mol |
| Exact Mass | 783.38 |
| IUPAC Name | [3-[(Z)-11,11-dihexoxyundec-4-enyl]-2-methylphenyl]-iodo-bis(2-methylphenyl)phosphanium |
| SMILES | CCCCCCOC(CCCCC/C=C\CCCc1cccc([P+](I)(c2ccccc2C)c2ccccc2C)c1C)OCCCCCC |
| InChI | InChI=1S/C44H65IO2P/c1-6-8-10-24-35-46-44(47-36-25-11-9-7-2)34-19-17-15-13-12-14-16-18-29-40-30-26-33-43(39(40)5)48(45,41-31-22-20-27-37(41)3)42-32-23-21-28-38(42)4/h12,14,20-23,26-28,30-33,44H,6-11,13,15-19,24-25,29,34-36H2,1-5H3/q+1/b14-12- |
| InChIKey | VDNGPNLNNJZRHQ-OWBHPGMISA-N |
| XLogP | 12.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.88 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|