About 4-tert-butyl-3,6-dimethylpyridazine;ethane
4-tert-butyl-3,6-dimethylpyridazine;ethane (PubChem CID 165399506) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 4-tert-butyl-3,6-dimethylpyridazine;ethane.
Molecular Properties
| Compound Name | 4-tert-butyl-3,6-dimethylpyridazine;ethane |
| PubChem CID | 165399506 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 4-tert-butyl-3,6-dimethylpyridazine;ethane |
| SMILES | CC.CC.Cc1cc(C(C)(C)C)c(C)nn1 |
| InChI | InChI=1S/C10H16N2.2C2H6/c1-7-6-9(10(3,4)5)8(2)12-11-7;2*1-2/h6H,1-5H3;2*1-2H3 |
| InChIKey | VAIPLYPILZRVAW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-3,6-dimethylpyridazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3,6-dimethylpyridazine;ethane?
The IUPAC name of 4-tert-butyl-3,6-dimethylpyridazine;ethane (CID 165399506) is 4-tert-butyl-3,6-dimethylpyridazine;ethane.
What is the SMILES notation for 4-tert-butyl-3,6-dimethylpyridazine;ethane?
The canonical SMILES for 4-tert-butyl-3,6-dimethylpyridazine;ethane is CC.CC.Cc1cc(C(C)(C)C)c(C)nn1.
What is the InChIKey of 4-tert-butyl-3,6-dimethylpyridazine;ethane?
The InChIKey is VAIPLYPILZRVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.2C2H6/c1-7-6-9(10(3,4)5)8(2)12-11-7;2*1-2/h6H,1-5H3;2*1-2H3.
What are the key properties of 4-tert-butyl-3,6-dimethylpyridazine;ethane?
4-tert-butyl-3,6-dimethylpyridazine;ethane has a molecular weight of 224.39 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3,6-dimethylpyridazine;ethane is sourced from PubChem (CID 165399506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).