C16H21N3O8 — CID 165408650
[(2R,5R)-5-cyano-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate (PubChem CID 165408650) has the molecular formula C16H21N3O8 and a molecular weight of 383.36 g/mol. Its IUPAC name is [(2R,5R)-5-cyano-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,5R)-5-cyano-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 165408650 |
| Molecular Formula | C16H21N3O8 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [(2R,5R)-5-cyano-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOC[C@H]1O[C@@](C#N)(n2ccc(=O)[nH]c2=O)C(O)C1O |
| InChI | InChI=1S/C16H21N3O8/c1-15(2,3)13(23)26-8-25-6-9-11(21)12(22)16(7-17,27-9)19-5-4-10(20)18-14(19)24/h4-5,9,11-12,21-22H,6,8H2,1-3H3,(H,18,20,24)/t9-,11?,12?,16-/m1/s1 |
| InChIKey | PSXRBMHVCQNQTQ-ZDAQOXLSSA-N |
| XLogP | -1.60 |
| TPSA | 163.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|