C17H11F9N4O7 — CID 165408714
[(1R,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-4-cyano-2,3-bis[(2,2,2-trifluoroacetyl)oxy]cyclopentyl]methyl 2,2,2-trifluoroacetate (PubChem CID 165408714) has the molecular formula C17H11F9N4O7 and a molecular weight of 554.28 g/mol. Its IUPAC name is [(1R,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-4-cyano-2,3-bis[(2,2,2-trifluoroacetyl)oxy]cyclopentyl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(1R,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-4-cyano-2,3-bis[(2,2,2-trifluoroacetyl)oxy]cyclopentyl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165408714 |
| Molecular Formula | C17H11F9N4O7 |
| Molecular Weight | 554.28 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | [(1R,4S)-4-(4-amino-2-oxopyrimidin-1-yl)-4-cyano-2,3-bis[(2,2,2-trifluoroacetyl)oxy]cyclopentyl]methyl 2,2,2-trifluoroacetate |
| SMILES | N#C[C@@]1(n2ccc(N)nc2=O)C[C@H](COC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H11F9N4O7/c18-15(19,20)10(31)35-4-6-3-14(5-27,30-2-1-7(28)29-13(30)34)9(37-12(33)17(24,25)26)8(6)36-11(32)16(21,22)23/h1-2,6,8-9H,3-4H2,(H2,28,29,34)/t6-,8?,9?,14+/m1/s1 |
| InChIKey | YQEHUEIRFDPJFO-IIYQHYISSA-N |
| XLogP | 1.12 |
| TPSA | 163.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|