C16H7F9N4O8 — CID 165408796
[(3S)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-bis[(2,2,2-trifluoroacetyl)oxy]-3H-furan-5-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 165408796) has the molecular formula C16H7F9N4O8 and a molecular weight of 554.23 g/mol. Its IUPAC name is [(3S)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-bis[(2,2,2-trifluoroacetyl)oxy]-3H-furan-5-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [(3S)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-bis[(2,2,2-trifluoroacetyl)oxy]-3H-furan-5-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 165408796 |
| Molecular Formula | C16H7F9N4O8 |
| Molecular Weight | 554.23 g/mol |
| Exact Mass | 554.01 |
| IUPAC Name | [(3S)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-bis[(2,2,2-trifluoroacetyl)oxy]-3H-furan-5-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | N#CC1(n2ccc(N)nc2=O)OC(COC(=O)C(F)(F)F)=C(OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H7F9N4O8/c17-14(18,19)9(30)34-3-5-7(35-10(31)15(20,21)22)8(36-11(32)16(23,24)25)13(4-26,37-5)29-2-1-6(27)28-12(29)33/h1-2,8H,3H2,(H2,27,28,33)/t8-,13?/m0/s1 |
| InChIKey | WYYYHXGEPVIMGL-OADYLZGLSA-N |
| XLogP | 0.93 |
| TPSA | 172.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|