C16H22N8O6 — CID 165408732
[(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-dihydroxy-3H-furan-5-yl]methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 165408732) has the molecular formula C16H22N8O6 and a molecular weight of 422.40 g/mol. Its IUPAC name is [(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-dihydroxy-3H-furan-5-yl]methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-dihydroxy-3H-furan-5-yl]methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 165408732 |
| Molecular Formula | C16H22N8O6 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [(2R)-2-(4-amino-2-oxopyrimidin-1-yl)-2-cyano-3,4-dihydroxy-3H-furan-5-yl]methyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | N#C[C@@]1(n2ccc(N)nc2=O)OC(COC(=O)[C@@H](N)CCCN=C(N)N)=C(O)C1O |
| InChI | InChI=1S/C16H22N8O6/c17-7-16(24-5-3-10(19)23-15(24)28)12(26)11(25)9(30-16)6-29-13(27)8(18)2-1-4-22-14(20)21/h3,5,8,12,25-26H,1-2,4,6,18H2,(H2,19,23,28)(H4,20,21,22)/t8-,12?,16+/m0/s1 |
| InChIKey | OECVKHWHPSVPTH-IEDXIUFRSA-N |
| XLogP | -2.91 |
| TPSA | 251.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|