C22H32N7O10P — CID 140532331
benzyl 2-amino-5-[[amino-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyamino]methylidene]amino]pentanoate (PubChem CID 140532331) has the molecular formula C22H32N7O10P and a molecular weight of 585.51 g/mol. Its IUPAC name is benzyl 2-amino-5-[[amino-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyamino]methylidene]amino]pentanoate.
| Compound Name | benzyl 2-amino-5-[[amino-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyamino]methylidene]amino]pentanoate |
|---|---|
| PubChem CID | 140532331 |
| Molecular Formula | C22H32N7O10P |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | benzyl 2-amino-5-[[amino-[[[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxyamino]methylidene]amino]pentanoate |
| SMILES | N/C(=N\CCCC(N)C(=O)OCc1ccccc1)NOP(=O)(O)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H32N7O10P/c23-14(20(32)36-11-13-5-2-1-3-6-13)7-4-9-26-21(25)28-39-40(34,35)37-12-15-17(30)18(31)19(38-15)29-10-8-16(24)27-22(29)33/h1-3,5-6,8,10,14-15,17-19,30-31H,4,7,9,11-12,23H2,(H,34,35)(H2,24,27,33)(H3,25,26,28)/t14?,15-,17-,18-,19-/m1/s1 |
| InChIKey | GGLVAQILTZQWKP-CYPDFVBJSA-N |
| XLogP | -1.75 |
| TPSA | 269.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|