C18H25N4O10P — CID 51001503
[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate;phosphoric acid (PubChem CID 51001503) has the molecular formula C18H25N4O10P and a molecular weight of 488.39 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate;phosphoric acid.
| Compound Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate;phosphoric acid |
|---|---|
| PubChem CID | 51001503 |
| Molecular Formula | C18H25N4O10P |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2S)-2-amino-3-phenylpropanoate;phosphoric acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](COC(=O)[C@@H](N)Cc3ccccc3)[C@@H](O)[C@@H]2O)c(=O)n1.O=P(O)(O)O |
| InChI | InChI=1S/C18H22N4O6.H3O4P/c19-11(8-10-4-2-1-3-5-10)17(25)27-9-12-14(23)15(24)16(28-12)22-7-6-13(20)21-18(22)26;1-5(2,3)4/h1-7,11-12,14-16,23-24H,8-9,19H2,(H2,20,21,26);(H3,1,2,3,4)/t11-,12+,14+,15-,16+;/m0./s1 |
| InChIKey | RVVZSAUOTJBKEN-DCFNXYTKSA-N |
| XLogP | -2.37 |
| TPSA | 240.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|