C19H24N2 — CID 165410230
1-(5-azatricyclo[12.4.0.04,9]octadeca-1(18),4(9),5,7,14,16-hexaen-3-yl)-N-methylmethanamine (PubChem CID 165410230) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(5-azatricyclo[12.4.0.04,9]octadeca-1(18),4(9),5,7,14,16-hexaen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(5-azatricyclo[12.4.0.04,9]octadeca-1(18),4(9),5,7,14,16-hexaen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 165410230 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(5-azatricyclo[12.4.0.04,9]octadeca-1(18),4(9),5,7,14,16-hexaen-3-yl)-N-methylmethanamine |
| SMILES | CNCC1Cc2ccccc2CCCCc2cccnc21 |
| InChI | InChI=1S/C19H24N2/c1-20-14-18-13-17-10-5-3-8-15(17)7-2-4-9-16-11-6-12-21-19(16)18/h3,5-6,8,10-12,18,20H,2,4,7,9,13-14H2,1H3 |
| InChIKey | INPPSZGWQMIQPI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |