C13H24N2 — CID 165411131
(3E,5Z)-6-amino-2,3-dimethyl-4-propan-2-ylhexa-3,5-dienenitrile;ethane (PubChem CID 165411131) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (3E,5Z)-6-amino-2,3-dimethyl-4-propan-2-ylhexa-3,5-dienenitrile;ethane.
| Compound Name | (3E,5Z)-6-amino-2,3-dimethyl-4-propan-2-ylhexa-3,5-dienenitrile;ethane |
|---|---|
| PubChem CID | 165411131 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (3E,5Z)-6-amino-2,3-dimethyl-4-propan-2-ylhexa-3,5-dienenitrile;ethane |
| SMILES | C/C(=C(\C=C/N)C(C)C)C(C)C#N.CC |
| InChI | InChI=1S/C11H18N2.C2H6/c1-8(2)11(5-6-12)10(4)9(3)7-13;1-2/h5-6,8-9H,12H2,1-4H3;1-2H3/b6-5-,11-10-; |
| InChIKey | LLUHFYPJPMXYJV-FYFNGVQZSA-N |
| XLogP | 3.62 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|