C13H20N2 — CID 167254968
(2Z,3E)-2-(1-aminoethylidene)-3-ethyl-4-propan-2-ylhexa-3,5-dienenitrile (PubChem CID 167254968) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2Z,3E)-2-(1-aminoethylidene)-3-ethyl-4-propan-2-ylhexa-3,5-dienenitrile.
| Compound Name | (2Z,3E)-2-(1-aminoethylidene)-3-ethyl-4-propan-2-ylhexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 167254968 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2Z,3E)-2-(1-aminoethylidene)-3-ethyl-4-propan-2-ylhexa-3,5-dienenitrile |
| SMILES | C=C/C(=C(CC)/C(C#N)=C(\C)N)C(C)C |
| InChI | InChI=1S/C13H20N2/c1-6-11(9(3)4)12(7-2)13(8-14)10(5)15/h6,9H,1,7,15H2,2-5H3/b12-11-,13-10+ |
| InChIKey | ALRBDLNGLXMUDO-QOLBIDBBSA-N |
| XLogP | 3.29 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|