C29H35F3N4O3 — CID 165414467
2-[4-[4-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethyl]benzoyl]piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 165414467) has the molecular formula C29H35F3N4O3 and a molecular weight of 544.62 g/mol. Its IUPAC name is 2-[4-[4-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethyl]benzoyl]piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[4-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethyl]benzoyl]piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 165414467 |
| Molecular Formula | C29H35F3N4O3 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 2-[4-[4-[2-[[3-(trifluoromethyl)phenyl]methoxy]ethyl]benzoyl]piperazin-1-yl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(N2CCN(C(=O)c3ccc(CCOCc4cccc(C(F)(F)F)c4)cc3)CC2)NC2CCCCC12 |
| InChI | InChI=1S/C29H35F3N4O3/c30-29(31,32)23-5-3-4-21(18-23)19-39-17-12-20-8-10-22(11-9-20)27(38)35-13-15-36(16-14-35)28-33-25-7-2-1-6-24(25)26(37)34-28/h3-5,8-11,18,24-25,28,33H,1-2,6-7,12-17,19H2,(H,34,37) |
| InChIKey | SFCHTHZKOQLZLC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|