C28H28ClN7O — CID 165417014
N'-[4-(4-benzhydrylpiperazin-1-yl)-6-chloro-1,3,5-triazin-2-yl]-2-phenylacetohydrazide (PubChem CID 165417014) has the molecular formula C28H28ClN7O and a molecular weight of 514.03 g/mol. Its IUPAC name is N'-[4-(4-benzhydrylpiperazin-1-yl)-6-chloro-1,3,5-triazin-2-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[4-(4-benzhydrylpiperazin-1-yl)-6-chloro-1,3,5-triazin-2-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 165417014 |
| Molecular Formula | C28H28ClN7O |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | N'-[4-(4-benzhydrylpiperazin-1-yl)-6-chloro-1,3,5-triazin-2-yl]-2-phenylacetohydrazide |
| SMILES | O=C(Cc1ccccc1)NNc1nc(Cl)nc(N2CCN(C(c3ccccc3)c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C28H28ClN7O/c29-26-30-27(34-33-24(37)20-21-10-4-1-5-11-21)32-28(31-26)36-18-16-35(17-19-36)25(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,25H,16-20H2,(H,33,37)(H,30,31,32,34) |
| InChIKey | ZRMNSJKPWRJLTK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|