C23H24ClN3OS — CID 139635234
N-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-3-ylacetamide (PubChem CID 139635234) has the molecular formula C23H24ClN3OS and a molecular weight of 425.99 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-3-ylacetamide.
| Compound Name | N-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 139635234 |
| Molecular Formula | C23H24ClN3OS |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)NN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H24ClN3OS/c24-21-8-6-20(7-9-21)23(19-4-2-1-3-5-19)26-11-13-27(14-12-26)25-22(28)16-18-10-15-29-17-18/h1-10,15,17,23H,11-14,16H2,(H,25,28) |
| InChIKey | AHOGGHQZKLFPPO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |