C16H21ClN6 — CID 165433324
2-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-ethyl-6-methylpyrimidin-4-amine (PubChem CID 165433324) has the molecular formula C16H21ClN6 and a molecular weight of 332.84 g/mol. Its IUPAC name is 2-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-ethyl-6-methylpyrimidin-4-amine.
| Compound Name | 2-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-ethyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 165433324 |
| Molecular Formula | C16H21ClN6 |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-ethyl-6-methylpyrimidin-4-amine |
| SMILES | CCNc1cc(C)nc(N2CCN(c3ncccc3Cl)CC2)n1 |
| InChI | InChI=1S/C16H21ClN6/c1-3-18-14-11-12(2)20-16(21-14)23-9-7-22(8-10-23)15-13(17)5-4-6-19-15/h4-6,11H,3,7-10H2,1-2H3,(H,18,20,21) |
| InChIKey | ZLGDWNLUMXVUJC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |