C20H25FN4O — CID 165435249
5-fluoro-4-[4-(oxan-2-ylmethyl)piperazin-1-yl]-6-phenylpyrimidine (PubChem CID 165435249) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is 5-fluoro-4-[4-(oxan-2-ylmethyl)piperazin-1-yl]-6-phenylpyrimidine.
| Compound Name | 5-fluoro-4-[4-(oxan-2-ylmethyl)piperazin-1-yl]-6-phenylpyrimidine |
|---|---|
| PubChem CID | 165435249 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 5-fluoro-4-[4-(oxan-2-ylmethyl)piperazin-1-yl]-6-phenylpyrimidine |
| SMILES | Fc1c(-c2ccccc2)ncnc1N1CCN(CC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H25FN4O/c21-18-19(16-6-2-1-3-7-16)22-15-23-20(18)25-11-9-24(10-12-25)14-17-8-4-5-13-26-17/h1-3,6-7,15,17H,4-5,8-14H2 |
| InChIKey | YXQTXHLSFLDJSW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |