C20H25FN2O — CID 165436471
2-(diethylamino)-N-[3-(4-fluorophenyl)-2,6-dimethylphenyl]acetamide (PubChem CID 165436471) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-(diethylamino)-N-[3-(4-fluorophenyl)-2,6-dimethylphenyl]acetamide.
| Compound Name | 2-(diethylamino)-N-[3-(4-fluorophenyl)-2,6-dimethylphenyl]acetamide |
|---|---|
| PubChem CID | 165436471 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-(diethylamino)-N-[3-(4-fluorophenyl)-2,6-dimethylphenyl]acetamide |
| SMILES | CCN(CC)CC(=O)Nc1c(C)ccc(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C20H25FN2O/c1-5-23(6-2)13-19(24)22-20-14(3)7-12-18(15(20)4)16-8-10-17(21)11-9-16/h7-12H,5-6,13H2,1-4H3,(H,22,24) |
| InChIKey | OEZRIKSWWGMUKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |