C26H27N3O6 — CID 165448828
5-[[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]methyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 165448828) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is 5-[[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]methyl]-1,3-oxazole-4-carboxylic acid.
| Compound Name | 5-[[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]methyl]-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 165448828 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 5-[[6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoylamino]methyl]-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(CCCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NCc1ocnc1C(=O)O |
| InChI | InChI=1S/C26H27N3O6/c30-23(28-14-22-24(25(31)32)29-16-35-22)12-2-1-7-13-27-26(33)34-15-21-19-10-5-3-8-17(19)18-9-4-6-11-20(18)21/h3-6,8-11,16,21H,1-2,7,12-15H2,(H,27,33)(H,28,30)(H,31,32) |
| InChIKey | SKQAOXBXEVUJFM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|