About 2-methyloxane-4-sulfinic acid
2-methyloxane-4-sulfinic acid (PubChem CID 165449790) has the molecular formula C6H12O3S
and a molecular weight of 164.23 g/mol. Its IUPAC name is 2-methyloxane-4-sulfinic acid.
Molecular Properties
| Compound Name | 2-methyloxane-4-sulfinic acid |
| PubChem CID | 165449790 |
| Molecular Formula | C6H12O3S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 2-methyloxane-4-sulfinic acid |
| SMILES | CC1CC(S(=O)O)CCO1 |
| InChI | InChI=1S/C6H12O3S/c1-5-4-6(10(7)8)2-3-9-5/h5-6H,2-4H2,1H3,(H,7,8) |
| InChIKey | PVEFZYYUWYAWMX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloxane-4-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloxane-4-sulfinic acid?
The IUPAC name of 2-methyloxane-4-sulfinic acid (CID 165449790) is 2-methyloxane-4-sulfinic acid.
What is the SMILES notation for 2-methyloxane-4-sulfinic acid?
The canonical SMILES for 2-methyloxane-4-sulfinic acid is CC1CC(S(=O)O)CCO1.
What is the InChIKey of 2-methyloxane-4-sulfinic acid?
The InChIKey is PVEFZYYUWYAWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3S/c1-5-4-6(10(7)8)2-3-9-5/h5-6H,2-4H2,1H3,(H,7,8).
What are the key properties of 2-methyloxane-4-sulfinic acid?
2-methyloxane-4-sulfinic acid has a molecular weight of 164.23 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxane-4-sulfinic acid is sourced from PubChem (CID 165449790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).