C15H30N2O3 — CID 165451025
tert-butyl N-[1-(2-methoxyethylamino)hept-6-en-2-yl]carbamate (PubChem CID 165451025) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methoxyethylamino)hept-6-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methoxyethylamino)hept-6-en-2-yl]carbamate |
|---|---|
| PubChem CID | 165451025 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl N-[1-(2-methoxyethylamino)hept-6-en-2-yl]carbamate |
| SMILES | C=CCCCC(CNCCOC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O3/c1-6-7-8-9-13(12-16-10-11-19-5)17-14(18)20-15(2,3)4/h6,13,16H,1,7-12H2,2-5H3,(H,17,18) |
| InChIKey | GDVORUGRCPMWMT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|