C7H10ClN3 — CID 165457989
3-(chloromethyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]pyridine (PubChem CID 165457989) has the molecular formula C7H10ClN3 and a molecular weight of 171.63 g/mol. Its IUPAC name is 3-(chloromethyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-(chloromethyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 165457989 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 3-(chloromethyl)-4,5,6,7-tetrahydro-2H-pyrazolo[3,4-b]pyridine |
| SMILES | ClCc1[nH]nc2c1CCCN2 |
| InChI | InChI=1S/C7H10ClN3/c8-4-6-5-2-1-3-9-7(5)11-10-6/h1-4H2,(H2,9,10,11) |
| InChIKey | WHYSWRSGLHEKCS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|