C11H13F3N2 — CID 165468437
3-methyl-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 165468437) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-methyl-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | 3-methyl-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 165468437 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 3-methyl-4-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | CC1(N)CNCC1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H13F3N2/c1-11(15)5-16-4-7(11)6-2-8(12)10(14)9(13)3-6/h2-3,7,16H,4-5,15H2,1H3 |
| InChIKey | BSCQCVYLXBUAJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|