C19H13FN4OS3 — CID 16549508
(E)-3-(1,3-benzothiazol-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 16549508) has the molecular formula C19H13FN4OS3 and a molecular weight of 428.54 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 16549508 |
| Molecular Formula | C19H13FN4OS3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[5-[(4-fluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1nc2ccccc2s1)Nc1nnc(SCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H13FN4OS3/c20-13-7-5-12(6-8-13)11-26-19-24-23-18(28-19)22-16(25)9-10-17-21-14-3-1-2-4-15(14)27-17/h1-10H,11H2,(H,22,23,25)/b10-9+ |
| InChIKey | ABUYZPRCMPZTPU-MDZDMXLPSA-N |
| XLogP | 5.23 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|