C11H16ClNOS — CID 165496494
4-(5-chloro-2-methylcyclohexyl)-2-methoxy-1,3-thiazole (PubChem CID 165496494) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 4-(5-chloro-2-methylcyclohexyl)-2-methoxy-1,3-thiazole.
| Compound Name | 4-(5-chloro-2-methylcyclohexyl)-2-methoxy-1,3-thiazole |
|---|---|
| PubChem CID | 165496494 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 4-(5-chloro-2-methylcyclohexyl)-2-methoxy-1,3-thiazole |
| SMILES | COc1nc(C2CC(Cl)CCC2C)cs1 |
| InChI | InChI=1S/C11H16ClNOS/c1-7-3-4-8(12)5-9(7)10-6-15-11(13-10)14-2/h6-9H,3-5H2,1-2H3 |
| InChIKey | RLGXBMSUYGRHPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|