C27H35O4S2+ — CID 166007927
[4-[3-(1-ethylcyclopentyl)oxycarbonylcyclohexyl]sulfonylphenyl]-methyl-phenylsulfanium (PubChem CID 166007927) has the molecular formula C27H35O4S2+ and a molecular weight of 487.71 g/mol. Its IUPAC name is [4-[3-(1-ethylcyclopentyl)oxycarbonylcyclohexyl]sulfonylphenyl]-methyl-phenylsulfanium.
| Compound Name | [4-[3-(1-ethylcyclopentyl)oxycarbonylcyclohexyl]sulfonylphenyl]-methyl-phenylsulfanium |
|---|---|
| PubChem CID | 166007927 |
| Molecular Formula | C27H35O4S2+ |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | [4-[3-(1-ethylcyclopentyl)oxycarbonylcyclohexyl]sulfonylphenyl]-methyl-phenylsulfanium |
| SMILES | CCC1(OC(=O)C2CCCC(S(=O)(=O)c3ccc([S+](C)c4ccccc4)cc3)C2)CCCC1 |
| InChI | InChI=1S/C27H35O4S2/c1-3-27(18-7-8-19-27)31-26(28)21-10-9-13-25(20-21)33(29,30)24-16-14-23(15-17-24)32(2)22-11-5-4-6-12-22/h4-6,11-12,14-17,21,25H,3,7-10,13,18-20H2,1-2H3/q+1 |
| InChIKey | DALVCXMFNVSCDS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|