C19H15N5O3S2 — CID 166028229
2-[7-[amino(1,3-benzothiazol-2-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 166028229) has the molecular formula C19H15N5O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-[7-[amino(1,3-benzothiazol-2-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[7-[amino(1,3-benzothiazol-2-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166028229 |
| Molecular Formula | C19H15N5O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-[7-[amino(1,3-benzothiazol-2-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NN(c1ccc2c(c1)OCCN2c1nc(C(=O)O)cs1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15N5O3S2/c20-24(19-21-12-3-1-2-4-16(12)29-19)11-5-6-14-15(9-11)27-8-7-23(14)18-22-13(10-28-18)17(25)26/h1-6,9-10H,7-8,20H2,(H,25,26) |
| InChIKey | SKXMUJNKXJVSAQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|