C24H25FNOS+ — CID 166038212
2-(7-fluoro-3-methyl-6-pentylsulfanyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 166038212) has the molecular formula C24H25FNOS+ and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-(7-fluoro-3-methyl-6-pentylsulfanyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(7-fluoro-3-methyl-6-pentylsulfanyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166038212 |
| Molecular Formula | C24H25FNOS+ |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-(7-fluoro-3-methyl-6-pentylsulfanyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | CCCCCSc1c(F)ccc2c1oc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C24H25FNOS/c1-4-5-8-15-28-24-19(25)13-12-18-17-11-10-16(2)21(22(17)27-23(18)24)20-9-6-7-14-26(20)3/h6-7,9-14H,4-5,8,15H2,1-3H3/q+1 |
| InChIKey | KJFWMTVRLQBRNX-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|