C25H28FNOP+ — CID 166038252
[3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methyl-pentylphosphane (PubChem CID 166038252) has the molecular formula C25H28FNOP+ and a molecular weight of 408.48 g/mol. Its IUPAC name is [3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methyl-pentylphosphane.
| Compound Name | [3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methyl-pentylphosphane |
|---|---|
| PubChem CID | 166038252 |
| Molecular Formula | C25H28FNOP+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [3-fluoro-7-methyl-6-(1-methylpyridin-1-ium-2-yl)dibenzofuran-4-yl]-methyl-pentylphosphane |
| SMILES | CCCCCP(C)c1c(F)ccc2c1oc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C25H28FNOP/c1-5-6-9-16-29(4)25-20(26)14-13-19-18-12-11-17(2)22(23(18)28-24(19)25)21-10-7-8-15-27(21)3/h7-8,10-15H,5-6,9,16H2,1-4H3/q+1 |
| InChIKey | IBFCHRZUYWGQRX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|