C45H87NO5 — CID 166042580
[(2R,3R,4S)-3,4-bis(2-hexyldecoxy)oxolan-2-yl]methyl 1,4-dimethylpiperidine-4-carboxylate (PubChem CID 166042580) has the molecular formula C45H87NO5 and a molecular weight of 722.19 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-bis(2-hexyldecoxy)oxolan-2-yl]methyl 1,4-dimethylpiperidine-4-carboxylate.
| Compound Name | [(2R,3R,4S)-3,4-bis(2-hexyldecoxy)oxolan-2-yl]methyl 1,4-dimethylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 166042580 |
| Molecular Formula | C45H87NO5 |
| Molecular Weight | 722.19 g/mol |
| Exact Mass | 721.66 |
| IUPAC Name | [(2R,3R,4S)-3,4-bis(2-hexyldecoxy)oxolan-2-yl]methyl 1,4-dimethylpiperidine-4-carboxylate |
| SMILES | CCCCCCCCC(CCCCCC)CO[C@@H]1[C@@H](OCC(CCCCCC)CCCCCCCC)CO[C@@H]1COC(=O)C1(C)CCN(C)CC1 |
| InChI | InChI=1S/C45H87NO5/c1-7-11-15-19-21-25-29-39(27-23-17-13-9-3)35-48-41-37-49-42(38-51-44(47)45(5)31-33-46(6)34-32-45)43(41)50-36-40(28-24-18-14-10-4)30-26-22-20-16-12-8-2/h39-43H,7-38H2,1-6H3/t39?,40?,41-,42+,43+/m0/s1 |
| InChIKey | PYZUVTHWRXUXOB-FLABDNAUSA-N |
| XLogP | 12.11 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.19 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|