C26H21Cl2N3O2 — CID 166044768
3-chloro-2-(2-chloroethoxy)-5-[2-[4-(2-oxo-1H-quinoxalin-6-yl)phenyl]propan-2-yl]benzonitrile (PubChem CID 166044768) has the molecular formula C26H21Cl2N3O2 and a molecular weight of 478.38 g/mol. Its IUPAC name is 3-chloro-2-(2-chloroethoxy)-5-[2-[4-(2-oxo-1H-quinoxalin-6-yl)phenyl]propan-2-yl]benzonitrile.
| Compound Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-(2-oxo-1H-quinoxalin-6-yl)phenyl]propan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 166044768 |
| Molecular Formula | C26H21Cl2N3O2 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-chloro-2-(2-chloroethoxy)-5-[2-[4-(2-oxo-1H-quinoxalin-6-yl)phenyl]propan-2-yl]benzonitrile |
| SMILES | CC(C)(c1ccc(-c2ccc3[nH]c(=O)cnc3c2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C26H21Cl2N3O2/c1-26(2,20-11-18(14-29)25(21(28)13-20)33-10-9-27)19-6-3-16(4-7-19)17-5-8-22-23(12-17)30-15-24(32)31-22/h3-8,11-13,15H,9-10H2,1-2H3,(H,31,32) |
| InChIKey | GLEXCGVRQVHLCM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|