C27H28Cl2N4O — CID 170523228
5-[2-[4-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile (PubChem CID 170523228) has the molecular formula C27H28Cl2N4O and a molecular weight of 495.45 g/mol. Its IUPAC name is 5-[2-[4-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile.
| Compound Name | 5-[2-[4-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile |
|---|---|
| PubChem CID | 170523228 |
| Molecular Formula | C27H28Cl2N4O |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 5-[2-[4-[6-(3-aminopyrrolidin-1-yl)-3-pyridinyl]phenyl]propan-2-yl]-3-chloro-2-(2-chloroethoxy)benzonitrile |
| SMILES | CC(C)(c1ccc(-c2ccc(N3CCC(N)C3)nc2)cc1)c1cc(Cl)c(OCCCl)c(C#N)c1 |
| InChI | InChI=1S/C27H28Cl2N4O/c1-27(2,22-13-20(15-30)26(24(29)14-22)34-12-10-28)21-6-3-18(4-7-21)19-5-8-25(32-16-19)33-11-9-23(31)17-33/h3-8,13-14,16,23H,9-12,17,31H2,1-2H3 |
| InChIKey | GUOCFOBLPDRTFH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|