C20H19F3NOS+ — CID 166053964
3,15-dimethyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene (PubChem CID 166053964) has the molecular formula C20H19F3NOS+ and a molecular weight of 378.44 g/mol. Its IUPAC name is 3,15-dimethyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene.
| Compound Name | 3,15-dimethyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene |
|---|---|
| PubChem CID | 166053964 |
| Molecular Formula | C20H19F3NOS+ |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3,15-dimethyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene |
| SMILES | Cc1ccc2scc3c2c1-c1c(c(CC(C)(C)C(F)(F)F)cc[n+]1C)O3 |
| InChI | InChI=1S/C20H19F3NOS/c1-11-5-6-14-16-13(10-26-14)25-18-12(9-19(2,3)20(21,22)23)7-8-24(4)17(18)15(11)16/h5-8,10H,9H2,1-4H3/q+1 |
| InChIKey | BQNVOYJHMDHTKG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|