C26H30O3 — CID 166059112
3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol (PubChem CID 166059112) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol.
| Compound Name | 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 166059112 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 3,4-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2Cc2cc(C)c(O)c(C)c2)cc(C)c1O |
| InChI | InChI=1S/C26H30O3/c1-14-7-20(8-15(2)24(14)27)12-22-11-18(5)26(29)19(6)23(22)13-21-9-16(3)25(28)17(4)10-21/h7-11,27-29H,12-13H2,1-6H3 |
| InChIKey | XMCZCEXFAHBYCN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |