C31H31IO — CID 166063696
5-benzhydryl-2-[2-iodo-3-[(2-methylpropan-2-yl)oxy]phenyl]-1,3-dimethylbenzene (PubChem CID 166063696) has the molecular formula C31H31IO and a molecular weight of 546.49 g/mol. Its IUPAC name is 5-benzhydryl-2-[2-iodo-3-[(2-methylpropan-2-yl)oxy]phenyl]-1,3-dimethylbenzene.
| Compound Name | 5-benzhydryl-2-[2-iodo-3-[(2-methylpropan-2-yl)oxy]phenyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 166063696 |
| Molecular Formula | C31H31IO |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 5-benzhydryl-2-[2-iodo-3-[(2-methylpropan-2-yl)oxy]phenyl]-1,3-dimethylbenzene |
| SMILES | Cc1cc(C(c2ccccc2)c2ccccc2)cc(C)c1-c1cccc(OC(C)(C)C)c1I |
| InChI | InChI=1S/C31H31IO/c1-21-19-25(29(23-13-8-6-9-14-23)24-15-10-7-11-16-24)20-22(2)28(21)26-17-12-18-27(30(26)32)33-31(3,4)5/h6-20,29H,1-5H3 |
| InChIKey | SNDFUFXVAQUGAD-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|