C25H24ClNO2S — CID 166064515
N-[4-chloro-2-(1-phenylethenyl)phenyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide (PubChem CID 166064515) has the molecular formula C25H24ClNO2S and a molecular weight of 437.99 g/mol. Its IUPAC name is N-[4-chloro-2-(1-phenylethenyl)phenyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide.
| Compound Name | N-[4-chloro-2-(1-phenylethenyl)phenyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 166064515 |
| Molecular Formula | C25H24ClNO2S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-[4-chloro-2-(1-phenylethenyl)phenyl]-4-methyl-N-(2-methylprop-2-enyl)benzenesulfonamide |
| SMILES | C=C(C)CN(c1ccc(Cl)cc1C(=C)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H24ClNO2S/c1-18(2)17-27(30(28,29)23-13-10-19(3)11-14-23)25-15-12-22(26)16-24(25)20(4)21-8-6-5-7-9-21/h5-16H,1,4,17H2,2-3H3 |
| InChIKey | JBFUMKRUBPSXJX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|