C24H20ClNO3S — CID 171482518
N-[2-[1-(4-chlorophenyl)ethenyl]phenyl]-N-(4-methylphenyl)sulfonylprop-2-enamide (PubChem CID 171482518) has the molecular formula C24H20ClNO3S and a molecular weight of 437.95 g/mol. Its IUPAC name is N-[2-[1-(4-chlorophenyl)ethenyl]phenyl]-N-(4-methylphenyl)sulfonylprop-2-enamide.
| Compound Name | N-[2-[1-(4-chlorophenyl)ethenyl]phenyl]-N-(4-methylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 171482518 |
| Molecular Formula | C24H20ClNO3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | N-[2-[1-(4-chlorophenyl)ethenyl]phenyl]-N-(4-methylphenyl)sulfonylprop-2-enamide |
| SMILES | C=CC(=O)N(c1ccccc1C(=C)c1ccc(Cl)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H20ClNO3S/c1-4-24(27)26(30(28,29)21-15-9-17(2)10-16-21)23-8-6-5-7-22(23)18(3)19-11-13-20(25)14-12-19/h4-16H,1,3H2,2H3 |
| InChIKey | QBOBPMZNSKECST-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|