C21H26N4O4S2 — CID 16606519
N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 16606519) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 16606519 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-(5-carbamoyl-2-pyrrolidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCCC2)c(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C21H26N4O4S2/c22-20(26)15-7-8-18(24-9-1-2-10-24)17(13-15)23-21(27)16-5-3-11-25(14-16)31(28,29)19-6-4-12-30-19/h4,6-8,12-13,16H,1-3,5,9-11,14H2,(H2,22,26)(H,23,27) |
| InChIKey | OXMWRGOHYWTWQV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |