C22H28N4O4S2 — CID 43052907
N-(5-carbamoyl-2-piperidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 43052907) has the molecular formula C22H28N4O4S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-(5-carbamoyl-2-piperidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-(5-carbamoyl-2-piperidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43052907 |
| Molecular Formula | C22H28N4O4S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | N-(5-carbamoyl-2-piperidin-1-ylphenyl)-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | NC(=O)c1ccc(N2CCCCC2)c(NC(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)c1 |
| InChI | InChI=1S/C22H28N4O4S2/c23-21(27)16-8-9-19(25-10-2-1-3-11-25)18(14-16)24-22(28)17-6-4-12-26(15-17)32(29,30)20-7-5-13-31-20/h5,7-9,13-14,17H,1-4,6,10-12,15H2,(H2,23,27)(H,24,28) |
| InChIKey | SYNDTNQRICKSQB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |