About [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate
[(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate (PubChem CID 166065472) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate |
| PubChem CID | 166065472 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate |
| SMILES | CC(O)CC/C(=C\OC(=O)C(C)O)C(N)=O |
| InChI | InChI=1S/C10H17NO5/c1-6(12)3-4-8(9(11)14)5-16-10(15)7(2)13/h5-7,12-13H,3-4H2,1-2H3,(H2,11,14)/b8-5+ |
| InChIKey | HFTYEBSNDPBYKW-VMPITWQZSA-N |
| XLogP | -0.56 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate?
The IUPAC name of [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate (CID 166065472) is [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate.
What is the SMILES notation for [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate?
The canonical SMILES for [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate is CC(O)CC/C(=C\OC(=O)C(C)O)C(N)=O.
What is the InChIKey of [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate?
The InChIKey is HFTYEBSNDPBYKW-VMPITWQZSA-N. The full InChI is InChI=1S/C10H17NO5/c1-6(12)3-4-8(9(11)14)5-16-10(15)7(2)13/h5-7,12-13H,3-4H2,1-2H3,(H2,11,14)/b8-5+.
What are the key properties of [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate?
[(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate has a molecular weight of 231.25 g/mol, XLogP of -0.56, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-carbamoyl-5-hydroxyhex-1-enyl] 2-hydroxypropanoate is sourced from PubChem (CID 166065472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).